C10H11Br2N5 — CID 10316512
3,5-dibromo-8-piperazin-1-ylimidazo[1,2-a]pyrazine (PubChem CID 10316512) has the molecular formula C10H11Br2N5 and a molecular weight of 361.04 g/mol. Its IUPAC name is 3,5-dibromo-8-piperazin-1-ylimidazo[1,2-a]pyrazine.
| Compound Name | 3,5-dibromo-8-piperazin-1-ylimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 10316512 |
| Molecular Formula | C10H11Br2N5 |
| Molecular Weight | 361.04 g/mol |
| Exact Mass | 358.94 |
| IUPAC Name | 3,5-dibromo-8-piperazin-1-ylimidazo[1,2-a]pyrazine |
| SMILES | Brc1cnc(N2CCNCC2)c2ncc(Br)n12 |
| InChI | InChI=1S/C10H11Br2N5/c11-7-5-14-9(16-3-1-13-2-4-16)10-15-6-8(12)17(7)10/h5-6,13H,1-4H2 |
| InChIKey | CEJIGBDVFFLFEB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 45.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.04 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |