About 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine
1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine (PubChem CID 11356415) has the molecular formula C10H14N6
and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine |
| PubChem CID | 11356415 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(N3CCNCC3)ncnc21 |
| InChI | InChI=1S/C10H14N6/c1-15-9-8(6-14-15)10(13-7-12-9)16-4-2-11-3-5-16/h6-7,11H,2-5H2,1H3 |
| InChIKey | USAIOAAYWNVXEH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine?
The IUPAC name of 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine (CID 11356415) is 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine.
What is the SMILES notation for 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine?
The canonical SMILES for 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine is Cn1ncc2c(N3CCNCC3)ncnc21.
What is the InChIKey of 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine?
The InChIKey is USAIOAAYWNVXEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6/c1-15-9-8(6-14-15)10(13-7-12-9)16-4-2-11-3-5-16/h6-7,11H,2-5H2,1H3.
What are the key properties of 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine?
1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine has a molecular weight of 218.26 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine is sourced from PubChem (CID 11356415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).