C10H14N6 — CID 11356415
1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine (PubChem CID 11356415) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 11356415 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-methyl-4-piperazin-1-ylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(N3CCNCC3)ncnc21 |
| InChI | InChI=1S/C10H14N6/c1-15-9-8(6-14-15)10(13-7-12-9)16-4-2-11-3-5-16/h6-7,11H,2-5H2,1H3 |
| InChIKey | USAIOAAYWNVXEH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |