C13H18ClN5 — CID 106838514
4-[4-(1-chloroethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine (PubChem CID 106838514) has the molecular formula C13H18ClN5 and a molecular weight of 279.77 g/mol. Its IUPAC name is 4-[4-(1-chloroethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 4-[4-(1-chloroethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 106838514 |
| Molecular Formula | C13H18ClN5 |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 4-[4-(1-chloroethyl)piperidin-1-yl]-1-methylpyrazolo[5,4-d]pyrimidine |
| SMILES | CC(Cl)C1CCN(c2ncnc3c2cnn3C)CC1 |
| InChI | InChI=1S/C13H18ClN5/c1-9(14)10-3-5-19(6-4-10)13-11-7-17-18(2)12(11)15-8-16-13/h7-10H,3-6H2,1-2H3 |
| InChIKey | UEFCWDBDWVGYNF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|