C9H14BrN5 — CID 16740450
5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine (PubChem CID 16740450) has the molecular formula C9H14BrN5 and a molecular weight of 272.15 g/mol. Its IUPAC name is 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine.
| Compound Name | 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine |
|---|---|
| PubChem CID | 16740450 |
| Molecular Formula | C9H14BrN5 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine |
| SMILES | Nc1ncc(Br)nc1N1CCCNCC1 |
| InChI | InChI=1S/C9H14BrN5/c10-7-6-13-8(11)9(14-7)15-4-1-2-12-3-5-15/h6,12H,1-5H2,(H2,11,13) |
| InChIKey | SHBAZYWQPREMSZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |