About 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine
5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine (PubChem CID 16740450) has the molecular formula C9H14BrN5
and a molecular weight of 272.15 g/mol. Its IUPAC name is 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine |
| PubChem CID | 16740450 |
| Molecular Formula | C9H14BrN5 |
| Molecular Weight | 272.15 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine |
| SMILES | Nc1ncc(Br)nc1N1CCCNCC1 |
| InChI | InChI=1S/C9H14BrN5/c10-7-6-13-8(11)9(14-7)15-4-1-2-12-3-5-15/h6,12H,1-5H2,(H2,11,13) |
| InChIKey | SHBAZYWQPREMSZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.15 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine?
The IUPAC name of 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine (CID 16740450) is 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine.
What is the SMILES notation for 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine?
The canonical SMILES for 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine is Nc1ncc(Br)nc1N1CCCNCC1.
What is the InChIKey of 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine?
The InChIKey is SHBAZYWQPREMSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrN5/c10-7-6-13-8(11)9(14-7)15-4-1-2-12-3-5-15/h6,12H,1-5H2,(H2,11,13).
What are the key properties of 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine?
5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine has a molecular weight of 272.15 g/mol, XLogP of 0.62, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(1,4-diazepan-1-yl)pyrazin-2-amine is sourced from PubChem (CID 16740450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).