C9H11Br2N3 — CID 87370742
3,5-dibromo-2-piperidin-1-ylpyrazine (PubChem CID 87370742) has the molecular formula C9H11Br2N3 and a molecular weight of 321.02 g/mol. Its IUPAC name is 3,5-dibromo-2-piperidin-1-ylpyrazine.
| Compound Name | 3,5-dibromo-2-piperidin-1-ylpyrazine |
|---|---|
| PubChem CID | 87370742 |
| Molecular Formula | C9H11Br2N3 |
| Molecular Weight | 321.02 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 3,5-dibromo-2-piperidin-1-ylpyrazine |
| SMILES | Brc1cnc(N2CCCCC2)c(Br)n1 |
| InChI | InChI=1S/C9H11Br2N3/c10-7-6-12-9(8(11)13-7)14-4-2-1-3-5-14/h6H,1-5H2 |
| InChIKey | HGIZYQXNOWPPKQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.02 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |