C10H12BrF2N3 — CID 167713490
5-bromo-2-(4,4-difluoropiperidin-1-yl)-3-methylpyrazine (PubChem CID 167713490) has the molecular formula C10H12BrF2N3 and a molecular weight of 292.13 g/mol. Its IUPAC name is 5-bromo-2-(4,4-difluoropiperidin-1-yl)-3-methylpyrazine.
| Compound Name | 5-bromo-2-(4,4-difluoropiperidin-1-yl)-3-methylpyrazine |
|---|---|
| PubChem CID | 167713490 |
| Molecular Formula | C10H12BrF2N3 |
| Molecular Weight | 292.13 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | 5-bromo-2-(4,4-difluoropiperidin-1-yl)-3-methylpyrazine |
| SMILES | Cc1nc(Br)cnc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H12BrF2N3/c1-7-9(14-6-8(11)15-7)16-4-2-10(12,13)3-5-16/h6H,2-5H2,1H3 |
| InChIKey | XNKGQRSVIHYZTH-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |