C10H10BrF2N5 — CID 177342514
3-azido-6-bromo-2-(4,4-difluoropiperidin-1-yl)pyridine (PubChem CID 177342514) has the molecular formula C10H10BrF2N5 and a molecular weight of 318.13 g/mol. Its IUPAC name is 3-azido-6-bromo-2-(4,4-difluoropiperidin-1-yl)pyridine.
| Compound Name | 3-azido-6-bromo-2-(4,4-difluoropiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 177342514 |
| Molecular Formula | C10H10BrF2N5 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | 3-azido-6-bromo-2-(4,4-difluoropiperidin-1-yl)pyridine |
| SMILES | [N-]=[N+]=Nc1ccc(Br)nc1N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H10BrF2N5/c11-8-2-1-7(16-17-14)9(15-8)18-5-3-10(12,13)4-6-18/h1-2H,3-6H2 |
| InChIKey | FYYGHYYRRHPKNZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 64.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|