About 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline
2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline (PubChem CID 148519917) has the molecular formula C18H20F4N4
and a molecular weight of 368.38 g/mol. Its IUPAC name is 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline.
Molecular Properties
| Compound Name | 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline |
| PubChem CID | 148519917 |
| Molecular Formula | C18H20F4N4 |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline |
| SMILES | FC1(F)CCN(c2nc(N3CCC(F)(F)CC3)c3ccccc3n2)CC1 |
| InChI | InChI=1S/C18H20F4N4/c19-17(20)5-9-25(10-6-17)15-13-3-1-2-4-14(13)23-16(24-15)26-11-7-18(21,22)8-12-26/h1-4H,5-12H2 |
| InChIKey | MOEXPBAJUGDHGK-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline?
The IUPAC name of 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline (CID 148519917) is 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline.
What is the SMILES notation for 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline?
The canonical SMILES for 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline is FC1(F)CCN(c2nc(N3CCC(F)(F)CC3)c3ccccc3n2)CC1.
What is the InChIKey of 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline?
The InChIKey is MOEXPBAJUGDHGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20F4N4/c19-17(20)5-9-25(10-6-17)15-13-3-1-2-4-14(13)23-16(24-15)26-11-7-18(21,22)8-12-26/h1-4H,5-12H2.
What are the key properties of 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline?
2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline has a molecular weight of 368.38 g/mol, XLogP of 4.10, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(4,4-difluoropiperidin-1-yl)quinazoline is sourced from PubChem (CID 148519917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).