C20H24F4N4O2 — CID 147825530
2,4-bis(4,4-difluoropiperidin-1-yl)-6,7-dimethoxyquinazoline (PubChem CID 147825530) has the molecular formula C20H24F4N4O2 and a molecular weight of 428.43 g/mol. Its IUPAC name is 2,4-bis(4,4-difluoropiperidin-1-yl)-6,7-dimethoxyquinazoline.
| Compound Name | 2,4-bis(4,4-difluoropiperidin-1-yl)-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 147825530 |
| Molecular Formula | C20H24F4N4O2 |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2,4-bis(4,4-difluoropiperidin-1-yl)-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2nc(N3CCC(F)(F)CC3)nc(N3CCC(F)(F)CC3)c2cc1OC |
| InChI | InChI=1S/C20H24F4N4O2/c1-29-15-11-13-14(12-16(15)30-2)25-18(28-9-5-20(23,24)6-10-28)26-17(13)27-7-3-19(21,22)4-8-27/h11-12H,3-10H2,1-2H3 |
| InChIKey | HQBMZVHOALLSQK-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |