C18H20F2N2O4 — CID 169264563
2-(4,4-difluoroazepan-1-yl)-6,7-dimethoxyquinoline-3-carboxylic acid (PubChem CID 169264563) has the molecular formula C18H20F2N2O4 and a molecular weight of 366.36 g/mol. Its IUPAC name is 2-(4,4-difluoroazepan-1-yl)-6,7-dimethoxyquinoline-3-carboxylic acid.
| Compound Name | 2-(4,4-difluoroazepan-1-yl)-6,7-dimethoxyquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 169264563 |
| Molecular Formula | C18H20F2N2O4 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 2-(4,4-difluoroazepan-1-yl)-6,7-dimethoxyquinoline-3-carboxylic acid |
| SMILES | COc1cc2cc(C(=O)O)c(N3CCCC(F)(F)CC3)nc2cc1OC |
| InChI | InChI=1S/C18H20F2N2O4/c1-25-14-9-11-8-12(17(23)24)16(21-13(11)10-15(14)26-2)22-6-3-4-18(19,20)5-7-22/h8-10H,3-7H2,1-2H3,(H,23,24) |
| InChIKey | STZGYULIZUGYHJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |