C17H19N3O4 — CID 53214897
2-(3,4-dimethoxyphenyl)-4-pyrrolidin-1-ylpyrimidine-5-carboxylic acid (PubChem CID 53214897) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-pyrrolidin-1-ylpyrimidine-5-carboxylic acid.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-pyrrolidin-1-ylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 53214897 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-pyrrolidin-1-ylpyrimidine-5-carboxylic acid |
| SMILES | COc1ccc(-c2ncc(C(=O)O)c(N3CCCC3)n2)cc1OC |
| InChI | InChI=1S/C17H19N3O4/c1-23-13-6-5-11(9-14(13)24-2)15-18-10-12(17(21)22)16(19-15)20-7-3-4-8-20/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,21,22) |
| InChIKey | PSGOOMRMGAXZAK-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |