C13H13N3O2S — CID 82169283
4-pyrrolidin-1-yl-2-thiophen-2-ylpyrimidine-5-carboxylic acid (PubChem CID 82169283) has the molecular formula C13H13N3O2S and a molecular weight of 275.33 g/mol. Its IUPAC name is 4-pyrrolidin-1-yl-2-thiophen-2-ylpyrimidine-5-carboxylic acid.
| Compound Name | 4-pyrrolidin-1-yl-2-thiophen-2-ylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 82169283 |
| Molecular Formula | C13H13N3O2S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 4-pyrrolidin-1-yl-2-thiophen-2-ylpyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(-c2cccs2)nc1N1CCCC1 |
| InChI | InChI=1S/C13H13N3O2S/c17-13(18)9-8-14-11(10-4-3-7-19-10)15-12(9)16-5-1-2-6-16/h3-4,7-8H,1-2,5-6H2,(H,17,18) |
| InChIKey | FFTYMPRSPUEEQX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |