C17H19N3O2 — CID 42669970
2-(4-methylphenyl)-4-piperidin-1-ylpyrimidine-5-carboxylic acid (PubChem CID 42669970) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is 2-(4-methylphenyl)-4-piperidin-1-ylpyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-methylphenyl)-4-piperidin-1-ylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 42669970 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(4-methylphenyl)-4-piperidin-1-ylpyrimidine-5-carboxylic acid |
| SMILES | Cc1ccc(-c2ncc(C(=O)O)c(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-12-5-7-13(8-6-12)15-18-11-14(17(21)22)16(19-15)20-9-3-2-4-10-20/h5-8,11H,2-4,9-10H2,1H3,(H,21,22) |
| InChIKey | UOPCACFQEHWDPK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |