C15H14FN3O3 — CID 53214965
2-(4-fluorophenyl)-4-morpholin-4-ylpyrimidine-5-carboxylic acid (PubChem CID 53214965) has the molecular formula C15H14FN3O3 and a molecular weight of 303.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4-morpholin-4-ylpyrimidine-5-carboxylic acid.
| Compound Name | 2-(4-fluorophenyl)-4-morpholin-4-ylpyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 53214965 |
| Molecular Formula | C15H14FN3O3 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(4-fluorophenyl)-4-morpholin-4-ylpyrimidine-5-carboxylic acid |
| SMILES | O=C(O)c1cnc(-c2ccc(F)cc2)nc1N1CCOCC1 |
| InChI | InChI=1S/C15H14FN3O3/c16-11-3-1-10(2-4-11)13-17-9-12(15(20)21)14(18-13)19-5-7-22-8-6-19/h1-4,9H,5-8H2,(H,20,21) |
| InChIKey | MXKBUJUWBGZYFF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |