C16H17F2N3O2 — CID 169264265
methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate (PubChem CID 169264265) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate.
| Compound Name | methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 169264265 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate |
| SMILES | COC(=O)c1nc2ccccc2nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C16H17F2N3O2/c1-23-15(22)13-14(20-12-6-3-2-5-11(12)19-13)21-9-4-7-16(17,18)8-10-21/h2-3,5-6H,4,7-10H2,1H3 |
| InChIKey | PDJBFBUHLURGMW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |