methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate

C16H17F2N3O2 — CID 169264265

IUPACmethyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate
SMILESCOC(=O)c1nc2ccccc2nc1N1CCCC(F)(F)CC1
InChIInChI=1S/C16H17F2N3O2/c1-23-15(22)13-14(20-12-6-3-2-5-11(12)19-13)21-9-4-7-16(17,18)8-10-21/h2-3,5-6H,4,7-10H2,1H3
InChIKeyPDJBFBUHLURGMW-UHFFFAOYSA-N
MW321.33 g/mol
LogP3.04
Rot. Bonds2

About methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate

methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate (PubChem CID 169264265) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate
PubChem CID169264265
Molecular FormulaC16H17F2N3O2
Molecular Weight321.33 g/mol
Exact Mass321.13
IUPAC Namemethyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate
SMILESCOC(=O)c1nc2ccccc2nc1N1CCCC(F)(F)CC1
InChIInChI=1S/C16H17F2N3O2/c1-23-15(22)13-14(20-12-6-3-2-5-11(12)19-13)21-9-4-7-16(17,18)8-10-21/h2-3,5-6H,4,7-10H2,1H3
InChIKeyPDJBFBUHLURGMW-UHFFFAOYSA-N
XLogP3.04
TPSA55.32 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500321.33
LogP ≤ 53.04
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate?
The IUPAC name of methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate (CID 169264265) is methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate.
What is the SMILES notation for methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate?
The canonical SMILES for methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate is COC(=O)c1nc2ccccc2nc1N1CCCC(F)(F)CC1.
What is the InChIKey of methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate?
The InChIKey is PDJBFBUHLURGMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17F2N3O2/c1-23-15(22)13-14(20-12-6-3-2-5-11(12)19-13)21-9-4-7-16(17,18)8-10-21/h2-3,5-6H,4,7-10H2,1H3.
What are the key properties of methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate?
methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate has a molecular weight of 321.33 g/mol, XLogP of 3.04, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(4,4-difluoroazepan-1-yl)quinoxaline-2-carboxylate is sourced from PubChem (CID 169264265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).