C17H17ClF2N2O2 — CID 170312236
methyl 2-(3-chloro-5,5-difluoroazepan-1-yl)quinoline-3-carboxylate (PubChem CID 170312236) has the molecular formula C17H17ClF2N2O2 and a molecular weight of 354.78 g/mol. Its IUPAC name is methyl 2-(3-chloro-5,5-difluoroazepan-1-yl)quinoline-3-carboxylate.
| Compound Name | methyl 2-(3-chloro-5,5-difluoroazepan-1-yl)quinoline-3-carboxylate |
|---|---|
| PubChem CID | 170312236 |
| Molecular Formula | C17H17ClF2N2O2 |
| Molecular Weight | 354.78 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | methyl 2-(3-chloro-5,5-difluoroazepan-1-yl)quinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2ccccc2nc1N1CCC(F)(F)CC(Cl)C1 |
| InChI | InChI=1S/C17H17ClF2N2O2/c1-24-16(23)13-8-11-4-2-3-5-14(11)21-15(13)22-7-6-17(19,20)9-12(18)10-22/h2-5,8,12H,6-7,9-10H2,1H3 |
| InChIKey | JPAWVQZAKLKUAW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.78 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|