C17H19F2N3O2 — CID 169263973
ethyl 2-(4,4-difluoroazepan-1-yl)-1,7-naphthyridine-3-carboxylate (PubChem CID 169263973) has the molecular formula C17H19F2N3O2 and a molecular weight of 335.35 g/mol. Its IUPAC name is ethyl 2-(4,4-difluoroazepan-1-yl)-1,7-naphthyridine-3-carboxylate.
| Compound Name | ethyl 2-(4,4-difluoroazepan-1-yl)-1,7-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 169263973 |
| Molecular Formula | C17H19F2N3O2 |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | ethyl 2-(4,4-difluoroazepan-1-yl)-1,7-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc2ccncc2nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C17H19F2N3O2/c1-2-24-16(23)13-10-12-4-7-20-11-14(12)21-15(13)22-8-3-5-17(18,19)6-9-22/h4,7,10-11H,2-3,5-6,8-9H2,1H3 |
| InChIKey | FSBBRCXWXBVCGT-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |