C16H24N2O3 — CID 107407268
ethyl 5-amino-2-(4-hydroxy-4-methylazepan-1-yl)benzoate (PubChem CID 107407268) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is ethyl 5-amino-2-(4-hydroxy-4-methylazepan-1-yl)benzoate.
| Compound Name | ethyl 5-amino-2-(4-hydroxy-4-methylazepan-1-yl)benzoate |
|---|---|
| PubChem CID | 107407268 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | ethyl 5-amino-2-(4-hydroxy-4-methylazepan-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc(N)ccc1N1CCCC(C)(O)CC1 |
| InChI | InChI=1S/C16H24N2O3/c1-3-21-15(19)13-11-12(17)5-6-14(13)18-9-4-7-16(2,20)8-10-18/h5-6,11,20H,3-4,7-10,17H2,1-2H3 |
| InChIKey | WFQVPVFACRPVGJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|