C17H26N2O2 — CID 65286422
ethyl 2-amino-5-(4,4-dimethylazepan-1-yl)benzoate (PubChem CID 65286422) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is ethyl 2-amino-5-(4,4-dimethylazepan-1-yl)benzoate.
| Compound Name | ethyl 2-amino-5-(4,4-dimethylazepan-1-yl)benzoate |
|---|---|
| PubChem CID | 65286422 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | ethyl 2-amino-5-(4,4-dimethylazepan-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc(N2CCCC(C)(C)CC2)ccc1N |
| InChI | InChI=1S/C17H26N2O2/c1-4-21-16(20)14-12-13(6-7-15(14)18)19-10-5-8-17(2,3)9-11-19/h6-7,12H,4-5,8-11,18H2,1-3H3 |
| InChIKey | LXYGAAFZSAOXGV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|