About 5-(4,4-dimethylazepan-1-yl)-2-methylaniline
5-(4,4-dimethylazepan-1-yl)-2-methylaniline (PubChem CID 65283379) has the molecular formula C15H24N2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 5-(4,4-dimethylazepan-1-yl)-2-methylaniline.
Molecular Properties
| Compound Name | 5-(4,4-dimethylazepan-1-yl)-2-methylaniline |
| PubChem CID | 65283379 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 5-(4,4-dimethylazepan-1-yl)-2-methylaniline |
| SMILES | Cc1ccc(N2CCCC(C)(C)CC2)cc1N |
| InChI | InChI=1S/C15H24N2/c1-12-5-6-13(11-14(12)16)17-9-4-7-15(2,3)8-10-17/h5-6,11H,4,7-10,16H2,1-3H3 |
| InChIKey | YTOYTVKYJUCOGY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(4,4-dimethylazepan-1-yl)-2-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4,4-dimethylazepan-1-yl)-2-methylaniline?
The IUPAC name of 5-(4,4-dimethylazepan-1-yl)-2-methylaniline (CID 65283379) is 5-(4,4-dimethylazepan-1-yl)-2-methylaniline.
What is the SMILES notation for 5-(4,4-dimethylazepan-1-yl)-2-methylaniline?
The canonical SMILES for 5-(4,4-dimethylazepan-1-yl)-2-methylaniline is Cc1ccc(N2CCCC(C)(C)CC2)cc1N.
What is the InChIKey of 5-(4,4-dimethylazepan-1-yl)-2-methylaniline?
The InChIKey is YTOYTVKYJUCOGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2/c1-12-5-6-13(11-14(12)16)17-9-4-7-15(2,3)8-10-17/h5-6,11H,4,7-10,16H2,1-3H3.
What are the key properties of 5-(4,4-dimethylazepan-1-yl)-2-methylaniline?
5-(4,4-dimethylazepan-1-yl)-2-methylaniline has a molecular weight of 232.37 g/mol, XLogP of 3.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4,4-dimethylazepan-1-yl)-2-methylaniline is sourced from PubChem (CID 65283379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).