C16H24N2O2 — CID 62932234
ethyl 2-amino-5-(4,4-dimethylpiperidin-1-yl)benzoate (PubChem CID 62932234) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 2-amino-5-(4,4-dimethylpiperidin-1-yl)benzoate.
| Compound Name | ethyl 2-amino-5-(4,4-dimethylpiperidin-1-yl)benzoate |
|---|---|
| PubChem CID | 62932234 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl 2-amino-5-(4,4-dimethylpiperidin-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc(N2CCC(C)(C)CC2)ccc1N |
| InChI | InChI=1S/C16H24N2O2/c1-4-20-15(19)13-11-12(5-6-14(13)17)18-9-7-16(2,3)8-10-18/h5-6,11H,4,7-10,17H2,1-3H3 |
| InChIKey | LLBSVHXZOYECMS-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|