About ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate
ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate (PubChem CID 104968336) has the molecular formula C16H24N2O2
and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate |
| PubChem CID | 104968336 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate |
| SMILES | CCOC(=O)c1cc(N2[C@H](C)CCC[C@@H]2C)ccc1N |
| InChI | InChI=1S/C16H24N2O2/c1-4-20-16(19)14-10-13(8-9-15(14)17)18-11(2)6-5-7-12(18)3/h8-12H,4-7,17H2,1-3H3/t11-,12+ |
| InChIKey | DOEJCHXKYOSOIH-TXEJJXNPSA-N |
| XLogP | 3.21 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate?
The IUPAC name of ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate (CID 104968336) is ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate.
What is the SMILES notation for ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate?
The canonical SMILES for ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate is CCOC(=O)c1cc(N2[C@H](C)CCC[C@@H]2C)ccc1N.
What is the InChIKey of ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate?
The InChIKey is DOEJCHXKYOSOIH-TXEJJXNPSA-N. The full InChI is InChI=1S/C16H24N2O2/c1-4-20-16(19)14-10-13(8-9-15(14)17)18-11(2)6-5-7-12(18)3/h8-12H,4-7,17H2,1-3H3/t11-,12+.
What are the key properties of ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate?
ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate has a molecular weight of 276.38 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-amino-5-[(2S,6R)-2,6-dimethylpiperidin-1-yl]benzoate is sourced from PubChem (CID 104968336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).