C12H14N4O3 — CID 83143326
ethyl 2-amino-5-(4-methyl-5-oxo-1,2,4-triazol-1-yl)benzoate (PubChem CID 83143326) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is ethyl 2-amino-5-(4-methyl-5-oxo-1,2,4-triazol-1-yl)benzoate.
| Compound Name | ethyl 2-amino-5-(4-methyl-5-oxo-1,2,4-triazol-1-yl)benzoate |
|---|---|
| PubChem CID | 83143326 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | ethyl 2-amino-5-(4-methyl-5-oxo-1,2,4-triazol-1-yl)benzoate |
| SMILES | CCOC(=O)c1cc(-n2ncn(C)c2=O)ccc1N |
| InChI | InChI=1S/C12H14N4O3/c1-3-19-11(17)9-6-8(4-5-10(9)13)16-12(18)15(2)7-14-16/h4-7H,3,13H2,1-2H3 |
| InChIKey | RPRIMKRKIAQOTE-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 92.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|