C13H19IN2O — CID 107403607
1-(4-amino-2-iodophenyl)-4-methylazepan-4-ol (PubChem CID 107403607) has the molecular formula C13H19IN2O and a molecular weight of 346.21 g/mol. Its IUPAC name is 1-(4-amino-2-iodophenyl)-4-methylazepan-4-ol.
| Compound Name | 1-(4-amino-2-iodophenyl)-4-methylazepan-4-ol |
|---|---|
| PubChem CID | 107403607 |
| Molecular Formula | C13H19IN2O |
| Molecular Weight | 346.21 g/mol |
| Exact Mass | 346.05 |
| IUPAC Name | 1-(4-amino-2-iodophenyl)-4-methylazepan-4-ol |
| SMILES | CC1(O)CCCN(c2ccc(N)cc2I)CC1 |
| InChI | InChI=1S/C13H19IN2O/c1-13(17)5-2-7-16(8-6-13)12-4-3-10(15)9-11(12)14/h3-4,9,17H,2,5-8,15H2,1H3 |
| InChIKey | KYXSEVUBAXSKTQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.21 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|