C15H22F2N2 — CID 65283617
3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline (PubChem CID 65283617) has the molecular formula C15H22F2N2 and a molecular weight of 268.35 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline.
| Compound Name | 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline |
|---|---|
| PubChem CID | 65283617 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline |
| SMILES | CC1(C)CCCN(c2ccc(N)cc2C(F)F)CC1 |
| InChI | InChI=1S/C15H22F2N2/c1-15(2)6-3-8-19(9-7-15)13-5-4-11(18)10-12(13)14(16)17/h4-5,10,14H,3,6-9,18H2,1-2H3 |
| InChIKey | UTRLUEPWLMEBCH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|