About 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline
3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline (PubChem CID 65283617) has the molecular formula C15H22F2N2
and a molecular weight of 268.35 g/mol. Its IUPAC name is 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline.
Molecular Properties
| Compound Name | 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline |
| PubChem CID | 65283617 |
| Molecular Formula | C15H22F2N2 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline |
| SMILES | CC1(C)CCCN(c2ccc(N)cc2C(F)F)CC1 |
| InChI | InChI=1S/C15H22F2N2/c1-15(2)6-3-8-19(9-7-15)13-5-4-11(18)10-12(13)14(16)17/h4-5,10,14H,3,6-9,18H2,1-2H3 |
| InChIKey | UTRLUEPWLMEBCH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline?
The IUPAC name of 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline (CID 65283617) is 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline.
What is the SMILES notation for 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline?
The canonical SMILES for 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline is CC1(C)CCCN(c2ccc(N)cc2C(F)F)CC1.
What is the InChIKey of 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline?
The InChIKey is UTRLUEPWLMEBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22F2N2/c1-15(2)6-3-8-19(9-7-15)13-5-4-11(18)10-12(13)14(16)17/h4-5,10,14H,3,6-9,18H2,1-2H3.
What are the key properties of 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline?
3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline has a molecular weight of 268.35 g/mol, XLogP of 4.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethyl)-4-(4,4-dimethylazepan-1-yl)aniline is sourced from PubChem (CID 65283617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).