C18H19F3N2 — CID 170368069
2-(4,4-difluoroazepan-1-yl)-7-fluoro-3-prop-1-en-2-ylquinoline (PubChem CID 170368069) has the molecular formula C18H19F3N2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-(4,4-difluoroazepan-1-yl)-7-fluoro-3-prop-1-en-2-ylquinoline.
| Compound Name | 2-(4,4-difluoroazepan-1-yl)-7-fluoro-3-prop-1-en-2-ylquinoline |
|---|---|
| PubChem CID | 170368069 |
| Molecular Formula | C18H19F3N2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(4,4-difluoroazepan-1-yl)-7-fluoro-3-prop-1-en-2-ylquinoline |
| SMILES | C=C(C)c1cc2ccc(F)cc2nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C18H19F3N2/c1-12(2)15-10-13-4-5-14(19)11-16(13)22-17(15)23-8-3-6-18(20,21)7-9-23/h4-5,10-11H,1,3,6-9H2,2H3 |
| InChIKey | ZDNCOGLCVPXUNG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |