C23H23ClF2N4S — CID 169264086
S-[3-[1-[6-chloro-2-(4,4-difluoroazepan-1-yl)quinolin-3-yl]ethenylamino]phenyl]thiohydroxylamine (PubChem CID 169264086) has the molecular formula C23H23ClF2N4S and a molecular weight of 460.98 g/mol. Its IUPAC name is S-[3-[1-[6-chloro-2-(4,4-difluoroazepan-1-yl)quinolin-3-yl]ethenylamino]phenyl]thiohydroxylamine.
| Compound Name | S-[3-[1-[6-chloro-2-(4,4-difluoroazepan-1-yl)quinolin-3-yl]ethenylamino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 169264086 |
| Molecular Formula | C23H23ClF2N4S |
| Molecular Weight | 460.98 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | S-[3-[1-[6-chloro-2-(4,4-difluoroazepan-1-yl)quinolin-3-yl]ethenylamino]phenyl]thiohydroxylamine |
| SMILES | C=C(Nc1cccc(SN)c1)c1cc2cc(Cl)ccc2nc1N1CCCC(F)(F)CC1 |
| InChI | InChI=1S/C23H23ClF2N4S/c1-15(28-18-4-2-5-19(14-18)31-27)20-13-16-12-17(24)6-7-21(16)29-22(20)30-10-3-8-23(25,26)9-11-30/h2,4-7,12-14,28H,1,3,8-11,27H2 |
| InChIKey | YITUHEZFCUHDBV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.98 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|