C13H11ClF2N2 — CID 163351362
6-chloro-2-(3,3-difluoropyrrolidin-1-yl)quinoline (PubChem CID 163351362) has the molecular formula C13H11ClF2N2 and a molecular weight of 268.69 g/mol. Its IUPAC name is 6-chloro-2-(3,3-difluoropyrrolidin-1-yl)quinoline.
| Compound Name | 6-chloro-2-(3,3-difluoropyrrolidin-1-yl)quinoline |
|---|---|
| PubChem CID | 163351362 |
| Molecular Formula | C13H11ClF2N2 |
| Molecular Weight | 268.69 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 6-chloro-2-(3,3-difluoropyrrolidin-1-yl)quinoline |
| SMILES | FC1(F)CCN(c2ccc3cc(Cl)ccc3n2)C1 |
| InChI | InChI=1S/C13H11ClF2N2/c14-10-2-3-11-9(7-10)1-4-12(17-11)18-6-5-13(15,16)8-18/h1-4,7H,5-6,8H2 |
| InChIKey | JFFPSSGIKSUJHU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.69 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |