C25H37F2N5O2S — CID 163791606
2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(propan-2-ylsulfanylmethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine (PubChem CID 163791606) has the molecular formula C25H37F2N5O2S and a molecular weight of 509.67 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(propan-2-ylsulfanylmethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(propan-2-ylsulfanylmethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
|---|---|
| PubChem CID | 163791606 |
| Molecular Formula | C25H37F2N5O2S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-N-(propan-2-ylsulfanylmethyl)-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-amine |
| SMILES | COc1cc2c(NCSC(C)C)nc(N3CCC(F)(F)CC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C25H37F2N5O2S/c1-18(2)35-17-28-23-19-15-21(33-3)22(34-14-6-11-31-9-4-5-10-31)16-20(19)29-24(30-23)32-12-7-25(26,27)8-13-32/h15-16,18H,4-14,17H2,1-3H3,(H,28,29,30) |
| InChIKey | BYBHNMOIPHWVPI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|