C22H29F2N9O2 — CID 165146435
2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-tetrazol-5-yl)quinazolin-4-amine (PubChem CID 165146435) has the molecular formula C22H29F2N9O2 and a molecular weight of 489.53 g/mol. Its IUPAC name is 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-tetrazol-5-yl)quinazolin-4-amine.
| Compound Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-tetrazol-5-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 165146435 |
| Molecular Formula | C22H29F2N9O2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-N-(2H-tetrazol-5-yl)quinazolin-4-amine |
| SMILES | COc1cc2c(Nc3nn[nH]n3)nc(N3CCC(F)(F)CC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C22H29F2N9O2/c1-34-17-13-15-16(14-18(17)35-12-4-9-32-7-2-3-8-32)25-21(33-10-5-22(23,24)6-11-33)27-19(15)26-20-28-30-31-29-20/h13-14H,2-12H2,1H3,(H2,25,26,27,28,29,30,31) |
| InChIKey | URNFGLLZJJMQEW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|