C23H30F2N6O2 — CID 163826836
2-[[2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]acetonitrile (PubChem CID 163826836) has the molecular formula C23H30F2N6O2 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[[2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]acetonitrile.
| Compound Name | 2-[[2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 163826836 |
| Molecular Formula | C23H30F2N6O2 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | 2-[[2-(4,4-difluoropiperidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)quinazolin-4-yl]amino]acetonitrile |
| SMILES | COc1cc2c(NCC#N)nc(N3CCC(F)(F)CC3)nc2cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C23H30F2N6O2/c1-32-19-15-17-18(16-20(19)33-14-4-11-30-9-2-3-10-30)28-22(29-21(17)27-8-7-26)31-12-5-23(24,25)6-13-31/h15-16H,2-6,8-14H2,1H3,(H,27,28,29) |
| InChIKey | JRJGFGUYFHQPPM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 86.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|