C11H10BrF3N2O — CID 167713998
(6-bromo-5-fluoro-2-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone (PubChem CID 167713998) has the molecular formula C11H10BrF3N2O and a molecular weight of 323.11 g/mol. Its IUPAC name is (6-bromo-5-fluoro-2-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone.
| Compound Name | (6-bromo-5-fluoro-2-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 167713998 |
| Molecular Formula | C11H10BrF3N2O |
| Molecular Weight | 323.11 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | (6-bromo-5-fluoro-2-pyridinyl)-(4,4-difluoropiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(F)c(Br)n1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H10BrF3N2O/c12-9-7(13)1-2-8(16-9)10(18)17-5-3-11(14,15)4-6-17/h1-2H,3-6H2 |
| InChIKey | BDLDFWNUUYABQD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.11 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|