C19H15F3N2O — CID 70789102
(4,4-difluoropiperidin-1-yl)-[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methanone (PubChem CID 70789102) has the molecular formula C19H15F3N2O and a molecular weight of 344.34 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 70789102 |
| Molecular Formula | C19H15F3N2O |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[5-[2-(3-fluorophenyl)ethynyl]-2-pyridinyl]methanone |
| SMILES | O=C(c1ccc(C#Cc2cccc(F)c2)cn1)N1CCC(F)(F)CC1 |
| InChI | InChI=1S/C19H15F3N2O/c20-16-3-1-2-14(12-16)4-5-15-6-7-17(23-13-15)18(25)24-10-8-19(21,22)9-11-24/h1-3,6-7,12-13H,8-11H2 |
| InChIKey | ISMMEUMBKHFIAN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|