C10H14BrN3 — CID 10131290
1-(6-bromo-3-pyridinyl)-1,4-diazepane (PubChem CID 10131290) has the molecular formula C10H14BrN3 and a molecular weight of 256.15 g/mol. Its IUPAC name is 1-(6-bromo-3-pyridinyl)-1,4-diazepane.
| Compound Name | 1-(6-bromo-3-pyridinyl)-1,4-diazepane |
|---|---|
| PubChem CID | 10131290 |
| Molecular Formula | C10H14BrN3 |
| Molecular Weight | 256.15 g/mol |
| Exact Mass | 255.04 |
| IUPAC Name | 1-(6-bromo-3-pyridinyl)-1,4-diazepane |
| SMILES | Brc1ccc(N2CCCNCC2)cn1 |
| InChI | InChI=1S/C10H14BrN3/c11-10-3-2-9(8-13-10)14-6-1-4-12-5-7-14/h2-3,8,12H,1,4-7H2 |
| InChIKey | JRNYLCIPPWHNEJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.15 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|