C16H17N7O — CID 162705855
2-piperazin-1-yl-4-[4-(1H-pyrazol-4-yl)phenoxy]-1,3,5-triazine (PubChem CID 162705855) has the molecular formula C16H17N7O and a molecular weight of 323.36 g/mol. Its IUPAC name is 2-piperazin-1-yl-4-[4-(1H-pyrazol-4-yl)phenoxy]-1,3,5-triazine.
| Compound Name | 2-piperazin-1-yl-4-[4-(1H-pyrazol-4-yl)phenoxy]-1,3,5-triazine |
|---|---|
| PubChem CID | 162705855 |
| Molecular Formula | C16H17N7O |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 2-piperazin-1-yl-4-[4-(1H-pyrazol-4-yl)phenoxy]-1,3,5-triazine |
| SMILES | c1nc(Oc2ccc(-c3cn[nH]c3)cc2)nc(N2CCNCC2)n1 |
| InChI | InChI=1S/C16H17N7O/c1-3-14(4-2-12(1)13-9-20-21-10-13)24-16-19-11-18-15(22-16)23-7-5-17-6-8-23/h1-4,9-11,17H,5-8H2,(H,20,21) |
| InChIKey | ZRVLXVYQTMCDIZ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |