C19H18N8 — CID 22032423
6-(1H-pyrazol-4-yl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinazoline (PubChem CID 22032423) has the molecular formula C19H18N8 and a molecular weight of 358.41 g/mol. Its IUPAC name is 6-(1H-pyrazol-4-yl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinazoline.
| Compound Name | 6-(1H-pyrazol-4-yl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinazoline |
|---|---|
| PubChem CID | 22032423 |
| Molecular Formula | C19H18N8 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 6-(1H-pyrazol-4-yl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)quinazoline |
| SMILES | c1cnc(N2CCN(c3ncnc4ccc(-c5cn[nH]c5)cc34)CC2)nc1 |
| InChI | InChI=1S/C19H18N8/c1-4-20-19(21-5-1)27-8-6-26(7-9-27)18-16-10-14(15-11-24-25-12-15)2-3-17(16)22-13-23-18/h1-5,10-13H,6-9H2,(H,24,25) |
| InChIKey | KSPPGVLRQGIIBQ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |