C22H23FN6 — CID 159342726
4-[4-(3-fluorophenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline;methane (PubChem CID 159342726) has the molecular formula C22H23FN6 and a molecular weight of 390.47 g/mol. Its IUPAC name is 4-[4-(3-fluorophenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline;methane.
| Compound Name | 4-[4-(3-fluorophenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline;methane |
|---|---|
| PubChem CID | 159342726 |
| Molecular Formula | C22H23FN6 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 4-[4-(3-fluorophenyl)piperazin-1-yl]-6-(1H-pyrazol-4-yl)quinazoline;methane |
| SMILES | C.Fc1cccc(N2CCN(c3ncnc4ccc(-c5cn[nH]c5)cc34)CC2)c1 |
| InChI | InChI=1S/C21H19FN6.CH4/c22-17-2-1-3-18(11-17)27-6-8-28(9-7-27)21-19-10-15(16-12-25-26-13-16)4-5-20(19)23-14-24-21;/h1-5,10-14H,6-9H2,(H,25,26);1H4 |
| InChIKey | LGIIEJSHVRQEEA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |