C14H18ClN3O4 — CID 87262071
4-(6-chloro-4-ethoxycarbonyl-5-methyl-2-pyridinyl)piperazine-1-carboxylic acid (PubChem CID 87262071) has the molecular formula C14H18ClN3O4 and a molecular weight of 327.77 g/mol. Its IUPAC name is 4-(6-chloro-4-ethoxycarbonyl-5-methyl-2-pyridinyl)piperazine-1-carboxylic acid.
| Compound Name | 4-(6-chloro-4-ethoxycarbonyl-5-methyl-2-pyridinyl)piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 87262071 |
| Molecular Formula | C14H18ClN3O4 |
| Molecular Weight | 327.77 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | 4-(6-chloro-4-ethoxycarbonyl-5-methyl-2-pyridinyl)piperazine-1-carboxylic acid |
| SMILES | CCOC(=O)c1cc(N2CCN(C(=O)O)CC2)nc(Cl)c1C |
| InChI | InChI=1S/C14H18ClN3O4/c1-3-22-13(19)10-8-11(16-12(15)9(10)2)17-4-6-18(7-5-17)14(20)21/h8H,3-7H2,1-2H3,(H,20,21) |
| InChIKey | JEWGLTDJIZZLHT-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 82.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.77 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|