C18H30N6O2 — CID 112870858
ethyl 4-[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]piperazine-1-carboxylate (PubChem CID 112870858) has the molecular formula C18H30N6O2 and a molecular weight of 362.48 g/mol. Its IUPAC name is ethyl 4-[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 112870858 |
| Molecular Formula | C18H30N6O2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | ethyl 4-[6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-yl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(c2cc(N3CCN(CC)CC3)nc(C)n2)CC1 |
| InChI | InChI=1S/C18H30N6O2/c1-4-21-6-8-22(9-7-21)16-14-17(20-15(3)19-16)23-10-12-24(13-11-23)18(25)26-5-2/h14H,4-13H2,1-3H3 |
| InChIKey | SKQJFLZAFOSBBO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |