C15H20F3N3O3 — CID 174741613
ethyl 2-amino-3-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate (PubChem CID 174741613) has the molecular formula C15H20F3N3O3 and a molecular weight of 347.34 g/mol. Its IUPAC name is ethyl 2-amino-3-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate.
| Compound Name | ethyl 2-amino-3-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 174741613 |
| Molecular Formula | C15H20F3N3O3 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | ethyl 2-amino-3-(piperazin-1-ylmethyl)-5-(trifluoromethoxy)benzoate |
| SMILES | CCOC(=O)c1cc(OC(F)(F)F)cc(CN2CCNCC2)c1N |
| InChI | InChI=1S/C15H20F3N3O3/c1-2-23-14(22)12-8-11(24-15(16,17)18)7-10(13(12)19)9-21-5-3-20-4-6-21/h7-8,20H,2-6,9,19H2,1H3 |
| InChIKey | VMGUXRCBOMVLBA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|