C20H28F3N3O4 — CID 118043082
tert-butyl 4-[[2-amino-3-ethoxycarbonyl-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate (PubChem CID 118043082) has the molecular formula C20H28F3N3O4 and a molecular weight of 431.46 g/mol. Its IUPAC name is tert-butyl 4-[[2-amino-3-ethoxycarbonyl-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[[2-amino-3-ethoxycarbonyl-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 118043082 |
| Molecular Formula | C20H28F3N3O4 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | tert-butyl 4-[[2-amino-3-ethoxycarbonyl-5-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)c1cc(C(F)(F)F)cc(CN2CCN(C(=O)OC(C)(C)C)CC2)c1N |
| InChI | InChI=1S/C20H28F3N3O4/c1-5-29-17(27)15-11-14(20(21,22)23)10-13(16(15)24)12-25-6-8-26(9-7-25)18(28)30-19(2,3)4/h10-11H,5-9,12,24H2,1-4H3 |
| InChIKey | IQHCCOJAJXAOTB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|