C21H32N2O2 — CID 123222957
tert-butyl 4-[(4-but-2-en-2-yl-2-methylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 123222957) has the molecular formula C21H32N2O2 and a molecular weight of 344.50 g/mol. Its IUPAC name is tert-butyl 4-[(4-but-2-en-2-yl-2-methylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(4-but-2-en-2-yl-2-methylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 123222957 |
| Molecular Formula | C21H32N2O2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | tert-butyl 4-[(4-but-2-en-2-yl-2-methylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | CC=C(C)c1ccc(CN2CCN(C(=O)OC(C)(C)C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H32N2O2/c1-7-16(2)18-8-9-19(17(3)14-18)15-22-10-12-23(13-11-22)20(24)25-21(4,5)6/h7-9,14H,10-13,15H2,1-6H3 |
| InChIKey | OFFMHBTTXKPHDG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |