C18H23F3N2O2 — CID 144834255
ethyl 2-amino-3-ethenyl-4-(piperidin-1-ylmethyl)-5-(trifluoromethyl)benzoate (PubChem CID 144834255) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is ethyl 2-amino-3-ethenyl-4-(piperidin-1-ylmethyl)-5-(trifluoromethyl)benzoate.
| Compound Name | ethyl 2-amino-3-ethenyl-4-(piperidin-1-ylmethyl)-5-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 144834255 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | ethyl 2-amino-3-ethenyl-4-(piperidin-1-ylmethyl)-5-(trifluoromethyl)benzoate |
| SMILES | C=Cc1c(N)c(C(=O)OCC)cc(C(F)(F)F)c1CN1CCCCC1 |
| InChI | InChI=1S/C18H23F3N2O2/c1-3-12-14(11-23-8-6-5-7-9-23)15(18(19,20)21)10-13(16(12)22)17(24)25-4-2/h3,10H,1,4-9,11,22H2,2H3 |
| InChIKey | YOLHHHYJWZLAJK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|