C14H19F3N2O2 — CID 117489558
1-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 117489558) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 117489558 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-[[4,5-dimethoxy-2-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | COc1cc(CN2CCNCC2)c(C(F)(F)F)cc1OC |
| InChI | InChI=1S/C14H19F3N2O2/c1-20-12-7-10(9-19-5-3-18-4-6-19)11(14(15,16)17)8-13(12)21-2/h7-8,18H,3-6,9H2,1-2H3 |
| InChIKey | QPXCQMPYEPUAKZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |