C14H21FN2O3 — CID 117457867
1-[(3-fluoro-2,4,5-trimethoxyphenyl)methyl]piperazine (PubChem CID 117457867) has the molecular formula C14H21FN2O3 and a molecular weight of 284.33 g/mol. Its IUPAC name is 1-[(3-fluoro-2,4,5-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(3-fluoro-2,4,5-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 117457867 |
| Molecular Formula | C14H21FN2O3 |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 1-[(3-fluoro-2,4,5-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1cc(CN2CCNCC2)c(OC)c(F)c1OC |
| InChI | InChI=1S/C14H21FN2O3/c1-18-11-8-10(9-17-6-4-16-5-7-17)13(19-2)12(15)14(11)20-3/h8,16H,4-7,9H2,1-3H3 |
| InChIKey | XAPZMONNFRJPKX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |