C12H16F2N2O — CID 115006374
1-[(3,4-difluoro-2-methoxyphenyl)methyl]piperazine (PubChem CID 115006374) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-[(3,4-difluoro-2-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-[(3,4-difluoro-2-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 115006374 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-[(3,4-difluoro-2-methoxyphenyl)methyl]piperazine |
| SMILES | COc1c(CN2CCNCC2)ccc(F)c1F |
| InChI | InChI=1S/C12H16F2N2O/c1-17-12-9(2-3-10(13)11(12)14)8-16-6-4-15-5-7-16/h2-3,15H,4-8H2,1H3 |
| InChIKey | MVQHPQKBCCKIPR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |