C14H20F2N2O — CID 117429097
1-[[5-(1,1-difluoroethyl)-2-methoxyphenyl]methyl]piperazine (PubChem CID 117429097) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-[[5-(1,1-difluoroethyl)-2-methoxyphenyl]methyl]piperazine.
| Compound Name | 1-[[5-(1,1-difluoroethyl)-2-methoxyphenyl]methyl]piperazine |
|---|---|
| PubChem CID | 117429097 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-[[5-(1,1-difluoroethyl)-2-methoxyphenyl]methyl]piperazine |
| SMILES | COc1ccc(C(C)(F)F)cc1CN1CCNCC1 |
| InChI | InChI=1S/C14H20F2N2O/c1-14(15,16)12-3-4-13(19-2)11(9-12)10-18-7-5-17-6-8-18/h3-4,9,17H,5-8,10H2,1-2H3 |
| InChIKey | RFMICGHNJMOBHF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |