C22H30N4O4 — CID 154293765
(2,3-dioxopyrrolidin-1-yl) 4-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 154293765) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is (2,3-dioxopyrrolidin-1-yl) 4-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | (2,3-dioxopyrrolidin-1-yl) 4-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 154293765 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (2,3-dioxopyrrolidin-1-yl) 4-[(2-methyl-3-piperidin-1-ylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | Cc1c(CN2CCN(C(=O)ON3CCC(=O)C3=O)CC2)cccc1N1CCCCC1 |
| InChI | InChI=1S/C22H30N4O4/c1-17-18(6-5-7-19(17)24-9-3-2-4-10-24)16-23-12-14-25(15-13-23)22(29)30-26-11-8-20(27)21(26)28/h5-7H,2-4,8-16H2,1H3 |
| InChIKey | MBGMLJLDCJZYEP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|