C20H25FN4O4 — CID 71744530
(2,5-dioxopyrrolidin-1-yl) 4-[(3-fluoro-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate (PubChem CID 71744530) has the molecular formula C20H25FN4O4 and a molecular weight of 404.44 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(3-fluoro-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(3-fluoro-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 71744530 |
| Molecular Formula | C20H25FN4O4 |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(3-fluoro-2-pyrrolidin-1-ylphenyl)methyl]piperazine-1-carboxylate |
| SMILES | O=C(ON1C(=O)CCC1=O)N1CCN(Cc2cccc(F)c2N2CCCC2)CC1 |
| InChI | InChI=1S/C20H25FN4O4/c21-16-5-3-4-15(19(16)23-8-1-2-9-23)14-22-10-12-24(13-11-22)20(28)29-25-17(26)6-7-18(25)27/h3-5H,1-2,6-14H2 |
| InChIKey | GWFOJGAIZKOBEG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|