C17H22F4N2O4 — CID 175255357
tert-butyl formate;1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)piperazine (PubChem CID 175255357) has the molecular formula C17H22F4N2O4 and a molecular weight of 394.37 g/mol. Its IUPAC name is tert-butyl formate;1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)piperazine.
| Compound Name | tert-butyl formate;1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)piperazine |
|---|---|
| PubChem CID | 175255357 |
| Molecular Formula | C17H22F4N2O4 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | tert-butyl formate;1-(2,2,3,3-tetrafluoro-1,4-benzodioxin-5-yl)piperazine |
| SMILES | CC(C)(C)OC=O.FC1(F)Oc2cccc(N3CCNCC3)c2OC1(F)F |
| InChI | InChI=1S/C12H12F4N2O2.C5H10O2/c13-11(14)12(15,16)20-10-8(2-1-3-9(10)19-11)18-6-4-17-5-7-18;1-5(2,3)7-4-6/h1-3,17H,4-7H2;4H,1-3H3 |
| InChIKey | KTDKHANMCWPOMQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|